CAS 114506-96-6
:3-phenylcyclohex-2-en-1-amine
Description:
3-Phenylcyclohex-2-en-1-amine, with the CAS number 114506-96-6, is an organic compound characterized by its cyclohexene structure, which features a phenyl group attached to the cyclohexene ring and an amine functional group. This compound typically exhibits a combination of aromatic and aliphatic properties due to the presence of the phenyl group and the cyclohexene moiety. The double bond in the cyclohexene ring contributes to its reactivity, allowing for potential electrophilic addition reactions. The amine group can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features suggest that it could be involved in various chemical reactions, including substitution and addition reactions, and it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Overall, 3-phenylcyclohex-2-en-1-amine is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C12H15N
InChI:InChI=1/C12H15N/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,9,12H,4,7-8,13H2
Synonyms:- 2-cyclohexen-1-amine, 3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
