CAS 114527-53-6
:1,2,3,4-TETRAHYDRO-QUINOLINE-3-CARBOXYLIC ACID
Description:
1,2,3,4-Tetrahydroquinoline-3-carboxylic acid is a bicyclic compound characterized by a fused ring structure that includes a quinoline moiety. This compound features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a carboxylic acid functional group (-COOH) contributes to its acidic properties and enhances its solubility in polar solvents. The molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. It may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific activities can vary based on structural modifications. The compound's CAS number, 114527-53-6, serves as a unique identifier for regulatory and research purposes. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 1,2,3,4-tetrahydroquinoline-3-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-4,8,11H,5-6H2,(H,12,13)
SMILES:c1ccc2c(c1)CC(CN2)C(=O)O
Synonyms:- 1,2,3,4-Tetrahydroquinoline-3-carboxylic acid
- 3-Quinolinecarboxylic Acid, 1,2,3,4-Tetrahydro-
- 1,2,3,4-tetrahydro-3-Quinolinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-
CAS:Formula:C10H11NO2Purity:97%Color and Shape:SolidMolecular weight:177.19981,2,3,4-Tetrahydroquinoline-3-carboxylic acid
CAS:<p>1,2,3,4-Tetrahydroquinoline-3-carboxylic acid</p>Purity:97%Molecular weight:177.20g/mol1,2,3,4-Tetrahydroquinoline-3-carboxylic acid
CAS:Formula:C10H11NO2Purity:97%Color and Shape:SolidMolecular weight:177.2031,2,3,4-Tetrahydroquinoline-3-carboxylic acid
CAS:<p>Tetrahydroquinoline-3-carboxylic acid is a crystalline, water-soluble compound. It is an intermediate in the synthesis of l-phenylalanine, paraformaldehyde and formaldehyde. Tetrahydroquinoline-3-carboxylic acid can be hydrolyzed to produce formic acid and hydrogen chloride. This product is also optically active and can be used as an indicator for hydroiodic acid.</p>Formula:C10H11NO2Purity:Min. 95%Molecular weight:177.2 g/mol



