CAS 114546-86-0
:(11β,16α)-9-Fluoro-11,17-dihydroxy-21-methoxy-16-methylpregna-1,4-diene-3,20-dione
Description:
The chemical substance known as (11β,16α)-9-Fluoro-11,17-dihydroxy-21-methoxy-16-methylpregna-1,4-diene-3,20-dione, with the CAS number 114546-86-0, is a synthetic corticosteroid. It exhibits anti-inflammatory and immunosuppressive properties, making it useful in various therapeutic applications, particularly in treating conditions such as asthma, allergies, and autoimmune disorders. The structure of this compound features a fluorine atom, hydroxyl groups, and a methoxy group, which contribute to its biological activity and potency. The presence of the pregnane steroid backbone is characteristic of corticosteroids, influencing its interaction with glucocorticoid receptors. This compound is typically administered in a controlled manner due to its potential side effects, which can include metabolic alterations and effects on the endocrine system. Its pharmacokinetics involve absorption, distribution, metabolism, and excretion, which are critical for determining dosing regimens in clinical settings. Overall, this compound represents a significant advancement in corticosteroid therapy, offering enhanced efficacy and specificity in treatment.
Formula:C23H31FO5
InChI:InChI=1S/C23H31FO5/c1-13-9-17-16-6-5-14-10-15(25)7-8-20(14,2)22(16,24)18(26)11-21(17,3)23(13,28)19(27)12-29-4/h7-8,10,13,16-18,26,28H,5-6,9,11-12H2,1-4H3/t13-,16+,17+,18+,20+,21+,22+,23+/m1/s1
InChI key:InChIKey=CNBXSWVTTSYJSE-HOGMHMTRSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](F)([C@@H](O)C1)[C@]4(C)C(CC3)=CC(=O)C=C4)[H])(C[C@@H](C)[C@@]2(C(COC)=O)O)[H]
Synonyms:- Dexamethasone 21-methyl ether
- Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17-dihydroxy-21-methoxy-16-methyl-, (11β,16α)-
- 21-O-Methyldexamethasone
- (11β,16α)-9-Fluoro-11,17-dihydroxy-21-methoxy-16-methylpregna-1,4-diene-3,20-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
