
CAS 114547-32-9
:6-[(1-Methylpentyl)amino]-1,3,5-triazine-2,4(1H,3H)-dithione
Description:
6-[(1-Methylpentyl)amino]-1,3,5-triazine-2,4(1H,3H)-dithione, with CAS number 114547-32-9, is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features a 1-methylpentyl group attached to an amino group, contributing to its unique properties and potential applications. The presence of the dithione functional group indicates that it contains sulfur, which can influence its reactivity and interactions with other substances. Typically, compounds of this nature may exhibit biological activity, making them of interest in fields such as agrochemicals or pharmaceuticals. The structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect solubility and stability. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular structure and the conditions under which they are measured. Safety data and handling precautions should be considered due to the potential toxicity associated with nitrogen and sulfur-containing compounds.
Formula:C9H16N4S2
InChI:InChI=1S/C9H16N4S2/c1-3-4-5-6(2)10-7-11-8(14)13-9(15)12-7/h6H,3-5H2,1-2H3,(H3,10,11,12,13,14,15)
InChI key:InChIKey=UJNSVIPNPJZVLK-UHFFFAOYSA-N
SMILES:N(C(CCCC)C)C=1NC(=S)NC(=S)N1
Synonyms:- 6-[(1-Methylpentyl)amino]-1,3,5-triazine-2,4(1H,3H)-dithione
- 1,3,5-Triazine-2,4(1H,3H)-dithione, 6-[(1-methylpentyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,5-Triazine-2,4(1H,3H)-dithione, 6-[(1-methylpentyl)amino]-
CAS:Formula:C9H16N4S2Molecular weight:244.3801
