CymitQuimica logo

CAS 114548-84-4

:

Phenol, 2-(1,1-dimethylethyl)-6-(1-methylethyl)-4-(3-pyridazinylamino)-

Description:
The chemical substance known as "Phenol, 2-(1,1-dimethylethyl)-6-(1-methylethyl)-4-(3-pyridazinylamino)-" with CAS number 114548-84-4 is a complex organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features multiple substituents, including tert-butyl and isopropyl groups, as well as a pyridazinylamino group, which contributes to its unique chemical properties. The presence of these functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals, due to their ability to interact with biological systems. The compound's molecular structure indicates it may exhibit specific reactivity patterns, such as hydrogen bonding and electrophilic substitution. Additionally, its solubility and stability can be influenced by the steric hindrance introduced by the bulky alkyl groups. Overall, this compound's characteristics make it a subject of interest for further research and development in chemical synthesis and application.
Formula:C17H23N3O
InChI:InChI=1/C17H23N3O/c1-11(2)13-9-12(19-15-7-6-8-18-20-15)10-14(16(13)21)17(3,4)5/h6-11,21H,1-5H3,(H,19,20)
SMILES:CC(C)c1cc(cc(c1O)C(C)(C)C)N=c1cccn[nH]1
Synonyms:
  • 2-tert-Butyl-6-(propan-2-yl)-4-(pyridazin-3-ylamino)benzolol
  • 2-tert-Butyl-6-(propan-2-yl)-4-(pyridazin-3-ylamino)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.