CymitQuimica logo

CAS 114565-66-1

:

1,8-Dihydroxy-4-[[4-[2-hydroxy-1-(hydroxymethyl)ethyl]phenyl]amino]-5-nitro-9,10-anthracenedione

Description:
1,8-Dihydroxy-4-[[4-[2-hydroxy-1-(hydroxymethyl)ethyl]phenyl]amino]-5-nitro-9,10-anthracenedione, with CAS number 114565-66-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an anthraquinone backbone. This compound features multiple functional groups, including hydroxyl (-OH) groups and a nitro (-NO2) group, contributing to its potential reactivity and solubility properties. The presence of the amino group linked to a phenyl ring suggests that it may exhibit biological activity, possibly as a dye or in pharmaceutical applications. Its structure indicates potential for intermolecular interactions, such as hydrogen bonding, which could influence its solubility in various solvents. Additionally, the nitro group may impart unique electronic properties, making it of interest in studies related to electron transfer or photochemical behavior. Overall, this compound's intricate structure and functional groups suggest a range of potential applications in materials science and medicinal chemistry, warranting further investigation into its properties and uses.
Formula:C23H18N2O8
InChI:InChI=1S/C23H18N2O8/c26-9-12(10-27)11-1-3-13(4-2-11)24-14-5-7-16(28)20-18(14)22(30)19-15(25(32)33)6-8-17(29)21(19)23(20)31/h1-8,12,24,26-29H,9-10H2
InChI key:InChIKey=OXIGDVJVFLVGMW-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=C(N(=O)=O)C=CC3O)=C(O)C=C1)C4=CC=C(C(CO)CO)C=C4
Synonyms:
  • 9,10-Anthracenedione, 1,8-dihydroxy-4-[[4-[2-hydroxy-1-(hydroxymethyl)ethyl]phenyl]amino]-5-nitro-
  • 1,8-Dihydroxy-4-[[4-[2-hydroxy-1-(hydroxymethyl)ethyl]phenyl]amino]-5-nitro-9,10-anthracenedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.