CymitQuimica logo

CAS 114566-60-8

:

6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one

Description:
6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 114566-60-8, is a chemical compound characterized by its complex structure, which includes a benzoxazine ring fused with a thiazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiazole and benzoxazine groups suggests that it may interact with biological systems, potentially influencing various biochemical pathways. Its molecular structure may confer specific reactivity patterns, making it suitable for applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a unique combination of heterocyclic chemistry that may offer insights into drug design and development.
Formula:C12H11N3O2S
InChI:InChI=1/C12H11N3O2S/c1-15-9-4-7(8-6-18-12(13)14-8)2-3-10(9)17-5-11(15)16/h2-4,6H,5H2,1H3,(H2,13,14)
SMILES:CN1c2cc(ccc2OCC1=O)c1csc(=N)[nH]1
Synonyms:
  • 2H-1,4-benzoxazin-3(4H)-one, 6-(2-amino-4-thiazolyl)-4-methyl-
  • 6-(2-Amino-1,3-thiazol-4-yl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.