CAS 114567-34-9
:Boeravinone B
Description:
Boeravinone B is a naturally occurring chemical compound classified as a naphthoquinone, derived from the plant species Boerhaavia diffusa, commonly known for its medicinal properties. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in pharmacological research. Boeravinone B is characterized by its unique molecular structure, which includes a naphthalene core with various functional groups that contribute to its reactivity and biological interactions. The compound is typically studied for its effects on cellular processes and its potential therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in experimental settings. As with many natural products, the extraction and purification processes can influence the yield and purity of Boeravinone B, impacting its efficacy in biological assays. Overall, Boeravinone B represents a significant area of interest in natural product chemistry and drug development.
Formula:C17H12O6
InChI:InChI=1S/C17H12O6/c1-7-9(18)6-11-13(14(7)19)15(20)12-8-4-2-3-5-10(8)23-17(21)16(12)22-11/h2-6,17-19,21H,1H3
InChI key:InChIKey=YVVDYYFGAWQOGB-UHFFFAOYSA-N
SMILES:O=C1C2=C(OC=3C1=C(O)C(C)=C(O)C3)C(O)OC=4C2=CC=CC4
Synonyms:- 6,9,11-Trihydroxy-10-methyl[1]benzopyrano[3,4-b][1]benzopyran-12(6H)-one
- Boeravinone B
- Melavoid
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one,6,9,11-trihydroxy-10-methyl-, (?à)-
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-, (±)-
- [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
[1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-
CAS:Formula:C17H12O6Molecular weight:312.2736Boeravinone B
CAS:Boeravinone B inhibits MdeA efflux and S. aureus biofilm formation; enhances mupirocin; shows potent anti-inflammatory effects in rats.Formula:C17H12O6Color and Shape:SolidMolecular weight:312.27Boeravinone b
CAS:Oxygen-heterocyclic compoundFormula:C17H12O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:312.286,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid
CAS:6,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid is a synthetic retinoid, which is derived from chemical modification of natural retinoids, compounds related to vitamin A. Its mode of action involves the regulation of gene expression by binding to retinoic acid receptors (RARs) and retinoid X receptors (RXRs), thereby modulating cellular differentiation, proliferation, and apoptosis pathways.Formula:C17H12O6Purity:Min. 95%Molecular weight:312.27 g/mol






