CAS 114567-34-9

Boeravinone B

Description:

Boeravinone B is a naturally occurring chemical compound classified as a naphthoquinone, derived from the plant species Boerhaavia diffusa, commonly known for its medicinal properties. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in pharmacological research. Boeravinone B is characterized by its unique molecular structure, which includes a naphthalene core with various functional groups that contribute to its reactivity and biological interactions. The compound is typically studied for its effects on cellular processes and its potential therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in experimental settings. As with many natural products, the extraction and purification processes can influence the yield and purity of Boeravinone B, impacting its efficacy in biological assays. Overall, Boeravinone B represents a significant area of interest in natural product chemistry and drug development.

Formula: C₁₇H₁₂O₆

InChI: InChI=1S/C17H12O6/c1-7-9(18)6-11-13(14(7)19)15(20)12-8-4-2-3-5-10(8)23-17(21)16(12)22-11/h2-6,17-19,21H,1H3

InChI key: InChIKey=YVVDYYFGAWQOGB-UHFFFAOYSA-N

SMILES: O=C1C2=C(OC=3C1=C(O)C(C)=C(O)C3)C(O)OC=4C2=CC=CC4

Synonyms:

• 6,9,11-Trihydroxy-10-methyl[1]benzopyrano[3,4-b][1]benzopyran-12(6H)-one
• Boeravinone B
• Melavoid
• [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one,6,9,11-trihydroxy-10-methyl-, (?à)-
• [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-, (±)-
• [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-

[1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl-

CAS: 114567-34-9

Formula: C₁₇H₁₂O₆

Molecular weight: 312.2736

Ref: IN-DA000EOS

Boeravinone B

CAS: 114567-34-9

Boeravinone B inhibits MdeA efflux and S. aureus biofilm formation; enhances mupirocin; shows potent anti-inflammatory effects in rats.

Formula: C₁₇H₁₂O₆

Color and Shape: Solid

Molecular weight: 312.27

Ref: TM-TN5466

Boeravinone B

CAS: 114567-34-9

Formula: C₁₇H₁₂O₆

Purity: 95%~99%

Molecular weight: 312.277

Ref: BP-SBP03032

Boeravinone B

CAS: 114567-34-9

Formula: C₁₇H₁₂O₆

Molecular weight: 312.28

Ref: 4Z-B-144001

Boeravinone b

CAS: 114567-34-9

Oxygen-heterocyclic compound

Formula: C₁₇H₁₂O₆

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 312.28

Ref: 5G-82488

Boeravinone B

Controlled Product

CAS: 114567-34-9

Formula: C₁₇H₁₂O₆

Color and Shape: Neat

Molecular weight: 312.27

Ref: TR-B039205

6,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid

CAS: 114567-34-9

6,9,11-Trihydroxy-10-methyl-6a,12a-dehydroretenoid is a synthetic retinoid, which is derived from chemical modification of natural retinoids, compounds related to vitamin A. Its mode of action involves the regulation of gene expression by binding to retinoic acid receptors (RARs) and retinoid X receptors (RXRs), thereby modulating cellular differentiation, proliferation, and apoptosis pathways.

Formula: C₁₇H₁₂O₆

Purity: Min. 95%

Molecular weight: 312.27 g/mol

Ref: 3D-PEA56734