CAS 114567-47-4

Ganoderiol F

Description:

Ganoderiol F is a triterpenoid compound primarily derived from the Ganoderma lucidum, commonly known as reishi mushroom. This substance is characterized by its complex molecular structure, which contributes to its various biological activities. Ganoderiol F exhibits potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. Its mechanism of action may involve the modulation of various signaling pathways and the inhibition of specific enzymes. Additionally, Ganoderiol F is known for its low toxicity profile, which enhances its appeal for therapeutic applications. The compound is typically studied in the context of traditional medicine and modern pharmacology, highlighting its potential benefits in health and wellness. As research continues, further elucidation of its properties and mechanisms may pave the way for its use in complementary and alternative medicine.

Formula: C₃₀H₄₆O₃

InChI: InChI=1S/C30H46O3/c1-20(8-7-9-21(18-31)19-32)22-12-16-30(6)24-10-11-25-27(2,3)26(33)14-15-28(25,4)23(24)13-17-29(22,30)5/h9-10,13,20,22,25,31-32H,7-8,11-12,14-19H2,1-6H3/t20-,22-,25+,28-,29-,30+/m1/s1

InChI key: InChIKey=JVGJXXNUVVQEIG-MCKXIFHVSA-N

SMILES: C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CCC=C(CO)CO)C)(CC2)[H]

Synonyms:

• Ganoderiol F
• Lanosta-7,9(11),24-trien-3-one, 26,27-dihydroxy-
• 26,27-Dihydroxylanosta-7,9(11),24-trien-3-one

Lanosta-7,9(11),24-trien-3-one, 26,27-dihydroxy-

CAS: 114567-47-4

Formula: C₃₀H₄₆O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 454.6844

Ref: IN-DA000EOP

Ganoderiol F

CAS: 114567-47-4

Formula: C₃₀H₄₆O₃

Purity: 95%~99%

Molecular weight: 454.695

Ref: BP-SBP00787

ganoderiol F

Controlled Product

CAS: 114567-47-4

Ganoderiol F is a bioactive compound that exhibits anticancer activity by inhibiting protein synthesis and cell division. It has been shown to inhibit the growth of cancer cells in vitro through receptor binding and inhibition of protein synthesis, leading to cell death. Ganoderiol F also inhibits the complement system, which is an important component of the immune system. The anticomplement activity exhibited by this compound may be due to its ability to inhibit enzyme activities involved in the formation of the C3 convertase.

Purity: Min. 95%

Ref: 3D-FG42654

Ganoderiol F

CAS: 114567-47-4

Ganoderiol F has anti-inflammatory, cytotoxic and anti-HIV activity, it inhibits activity of topoisomerases in vitro, and it inhibits human immunodeficiency

Formula: C₃₀H₄₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 454.68

Ref: TM-TMA1012