
CAS 114567-50-9
:(15α,24E)-15-Hydroxy-3,11-dioxolanosta-8,24-dien-26-oic acid
Description:
(15α,24E)-15-Hydroxy-3,11-dioxolanosta-8,24-dien-26-oic acid, with the CAS number 114567-50-9, is a chemical compound that belongs to the class of triterpenoids, specifically a type of steroid. This compound features a complex polycyclic structure characterized by multiple rings and functional groups, including a hydroxyl group and a dioxolane moiety. Its structural configuration indicates that it possesses stereochemical specificity, which can influence its biological activity. Triterpenoids are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The presence of the hydroxyl group suggests potential for hydrogen bonding, which may enhance solubility in polar solvents and influence interactions with biological targets. Additionally, the diene system in the structure may contribute to its reactivity and stability under certain conditions. Overall, this compound's unique structural features and functional groups make it a subject of interest in medicinal chemistry and natural product research.
Formula:C30H44O5
InChI:InChI=1S/C30H44O5/c1-17(9-8-10-18(2)26(34)35)20-15-24(33)30(7)19-11-12-22-27(3,4)23(32)13-14-28(22,5)25(19)21(31)16-29(20,30)6/h10,17,20,22,24,33H,8-9,11-16H2,1-7H3,(H,34,35)/b18-10+/t17-,20-,22+,24+,28+,29-,30-/m1/s1
InChI key:InChIKey=XRBLVCACUHPHDE-NKRIBODASA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(C[C@@H]2O)[H]
Synonyms:- Ganolucidic acid E
- Lanosta-8,24-dien-26-oic acid, 15-hydroxy-3,11-dioxo-, (15α,24E)-
- (15α,24E)-15-Hydroxy-3,11-dioxolanosta-8,24-dien-26-oic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ganolucidic acid E
CAS:Ganolucidic acid E effectively suppresses the proliferation of three human cancer cell lines: Caco-2 (colon cancer), HepG2 (hepatocellular carcinoma), and HeLa (cervical cancer).Formula:C30H44O5Color and Shape:SolidMolecular weight:484.7
