CAS 114568-20-6

2,6-Dimethoxy-β-oxobenzenepropanal

Description:

2,6-Dimethoxy-β-oxobenzenepropanal, with the CAS number 114568-20-6, is an organic compound characterized by its unique molecular structure, which includes a benzene ring substituted with two methoxy groups and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents due to its hydrophobic aromatic components. The presence of the aldehyde group suggests it may participate in various chemical reactions, such as oxidation and condensation. Its methoxy substituents can influence its reactivity and polarity, potentially enhancing its solubility in polar solvents. Additionally, the β-oxo group indicates that it may exhibit keto-enol tautomerism, which can affect its stability and reactivity. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can facilitate further chemical transformations. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c1-14-9-4-3-5-10(15-2)11(9)8(13)6-7-12/h3-5,7H,6H2,1-2H3

InChI key: InChIKey=ODGQWNFWOCTITL-UHFFFAOYSA-N

SMILES: C(CC=O)(=O)C1=C(OC)C=CC=C1OC

Synonyms:

• Benzenepropanal, 2,6-dimethoxy-β-oxo-
• 2,6-Dimethoxy-β-oxobenzenepropanal