CymitQuimica logo

CAS 114580-19-7

:

(S)-4-CBZ-THIOMORPHOLINE-3-CARBOXYLIC ACID

Description:
(S)-4-CBZ-Thiomorpholine-3-carboxylic acid, with the CAS number 114580-19-7, is a chiral compound that belongs to the class of thiomorpholines. This substance features a thiomorpholine ring, which is a six-membered heterocyclic structure containing both sulfur and nitrogen atoms. The "CBZ" in its name indicates the presence of a carbobenzyloxy (CBZ) protecting group, commonly used in organic synthesis to protect amines. The compound is characterized by its carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. As a chiral molecule, it can exist in two enantiomeric forms, with the (S) configuration being one of them, which may impart specific biological activities or interactions. This compound is of interest in medicinal chemistry and drug development, particularly in the synthesis of pharmaceuticals where thiomorpholine derivatives may exhibit desired biological properties. Its physical and chemical properties, such as solubility and stability, can vary based on the specific conditions and environment in which it is studied.
Formula:C13H15NO4S
InChI:InChI=1/C13H15NO4S/c15-12(16)11-9-19-7-6-14(11)13(17)18-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)/t11-/m0/s1
SMILES:c1ccc(cc1)COC(=O)N1CCSC[C@H]1C(=O)O
Synonyms:
  • (3R)-4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylic acid
  • 3,4-thiomorpholinedicarboxylic acid, 4-(phenylmethyl) ester, (3R)-
  • acide (3R)-4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylique
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.