CAS 114580-22-2
:(R)-4-CBZ-THIOMORPHOLINE-3-CARBOXYLIC ACID
Description:
(R)-4-CBZ-THIOMORPHOLINE-3-CARBOXYLIC ACID, with the CAS number 114580-22-2, is a chiral compound that belongs to the class of thiomorpholine derivatives. This substance features a thiomorpholine ring, which is a six-membered heterocyclic structure containing a sulfur atom, contributing to its unique chemical properties. The presence of the carbobenzyloxy (CBZ) group enhances its stability and solubility, making it useful in various chemical applications, particularly in the synthesis of peptides and other biologically active molecules. The carboxylic acid functional group provides acidic characteristics, allowing for potential interactions in biochemical processes. As a chiral molecule, it exhibits optical activity, which is significant in pharmaceutical applications where the specific enantiomer may have distinct biological effects. Overall, (R)-4-CBZ-THIOMORPHOLINE-3-CARBOXYLIC ACID is valued for its structural complexity and versatility in organic synthesis and medicinal chemistry.
Formula:C13H15NO4S
InChI:InChI=1/C13H15NO4S/c15-12(16)11-9-19-7-6-14(11)13(17)18-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)/t11-/m1/s1
SMILES:c1ccc(cc1)COC(=O)N1CCSC[C@@H]1C(=O)O
Synonyms:- (3S)-4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylic acid
- 3,4-thiomorpholinedicarboxylic acid, 4-(phenylmethyl) ester, (3S)-
- acide (3S)-4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylique
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
