
CAS 114590-36-2
:Ethanedithioamide, compd. with pyridine (2:1)
Description:
Ethanedithioamide, compd. with pyridine (2:1), is a chemical compound characterized by its unique structure, which includes ethanedithioamide and pyridine in a 2:1 molar ratio. This compound typically exhibits properties associated with both its amide and pyridine components, such as potential solubility in polar solvents and the ability to engage in hydrogen bonding due to the presence of the amide functional group. The pyridine component contributes to its aromatic character and may influence its reactivity and stability. This compound may be utilized in various chemical applications, including synthesis and coordination chemistry, due to the presence of sulfur in the ethanedithioamide, which can participate in coordination with metal ions. Additionally, the interaction between the ethanedithioamide and pyridine can lead to unique physical and chemical properties, making it of interest in research and industrial applications. Safety data should be consulted for handling and storage, as compounds containing sulfur and nitrogen can pose specific hazards.
Formula:C5H5N·2C2H4N2S2
InChI:InChI=1S/C5H5N.C2H4N2S2/c1-2-4-6-5-3-1;3-1(5)2(4)6/h1-5H;(H2,3,5)(H2,4,6)
InChI key:InChIKey=LLTVHZKZNIXCMB-UHFFFAOYSA-N
SMILES:C=1C=CN=CC1.C(C(N)=S)(N)=S
Synonyms:- Pyridine, compd. with ethanedithioamide (1:2)
- Ethanedithioamide, compd. with pyridine (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
