
CAS 114590-44-2
:D-Apio-β-D-furanoside, 3,4-dihydro-3,5-dihydroxy-2-(4-hydroxyphenyl)-2H-1-benzopyran-7-yl, (2R-trans)-
Description:
D-Apio-β-D-furanoside, 3,4-dihydro-3,5-dihydroxy-2-(4-hydroxyphenyl)-2H-1-benzopyran-7-yl, with the CAS number 114590-44-2, is a chemical compound characterized by its complex structure, which includes a benzopyran moiety and a furanoside unit. This compound features multiple hydroxyl groups, contributing to its potential for hydrogen bonding and solubility in polar solvents. The presence of the 4-hydroxyphenyl group suggests possible antioxidant properties, as phenolic compounds are known for their ability to scavenge free radicals. The stereochemistry indicated by the (2R-trans) configuration may influence its biological activity and interaction with other molecules. This compound may be of interest in various fields, including medicinal chemistry and natural product research, due to its potential therapeutic applications. However, specific biological activities, stability, and reactivity would require further investigation through experimental studies to fully understand its characteristics and potential uses.
Formula:C20H22O9
InChI:InChI=1S/C20H22O9/c21-8-20(26)9-27-19(18(20)25)28-12-5-14(23)13-7-15(24)17(29-16(13)6-12)10-1-3-11(22)4-2-10/h1-6,15,17-19,21-26H,7-9H2/t15-,17+,18-,19-,20+/m0/s1
InChI key:InChIKey=BJBAEYMVZJJUEM-AXDKOMKPSA-N
SMILES:OC1=C2C(O[C@@H]([C@@H](O)C2)C3=CC=C(O)C=C3)=CC(O[C@H]4[C@H](O)[C@](CO)(O)CO4)=C1
Synonyms:- D-Apio-β-D-furanoside, 3,4-dihydro-3,5-dihydroxy-2-(4-hydroxyphenyl)-2H-1-benzopyran-7-yl, (2R-trans)-
- (+)-Afzelechin-7-O-β-L-apiofuranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Afzelechin 7-apioside
CAS:Afzelechin 7-apioside is a useful organic compound for research related to life sciences. The catalog number is T126339 and the CAS number is 114590-44-2.Formula:C20H22O9Color and Shape:SolidMolecular weight:406.387
