CAS 1146-04-9
:illudin M
Description:
Illudin M, with the CAS number 1146-04-9, is a naturally occurring compound derived from the fungus Omphalotus illudens, commonly known as the jack-o'-lantern mushroom. This compound is classified as a sesquiterpene and is known for its potent antifungal and cytotoxic properties. Illudin M exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. It has garnered interest in medicinal chemistry due to its potential applications in cancer treatment, as it can induce apoptosis in certain cancer cell lines. However, its use is limited by toxicity and stability concerns. Illudin M is typically studied in the context of its mechanism of action, which involves the disruption of cellular processes in target organisms. Research continues to explore its derivatives and analogs to enhance efficacy and reduce side effects. Overall, illudin M represents a fascinating example of how natural products can lead to the discovery of novel therapeutic agents.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-8-10-9(7-13(2,3)12(10)17)11(16)14(4,18)15(8)5-6-15/h7,12,17-18H,5-6H2,1-4H3/t12-,14+/m1/s1
InChI key:InChIKey=QVMDIQLUNODCTG-OCCSQVGLSA-N
SMILES:CC=1C2([C@@](C)(O)C(=O)C=3C1[C@@H](O)C(C)(C)C3)CC2
Synonyms:- (3'S,6'R)-3',6'-dihydroxy-2',2',4',6'-tetramethyl-2',3'-dihydrospiro[cyclopropane-1,5'-inden]-7'(6'H)-one
- (3′S,6′R)-2′,3′-Dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
- Brn 2286081
- Ccris 3539
- Dr-15977
- Illudine M
- Nsc 400978
- Nsc 626370
- Spiro(cyclopropane-1,5'-(5H)inden)-7'(6'H)-one, 2',3'-dihydro-3'-beta,6'-alpha-dihydroxy-2',24',6'-tetramethyl-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 2′,3′-dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethyl-, (3′S,6′R)-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 2′,3′-dihydro-3′,6′-dihydroxy-2′,2′,4′,6′-tetramethyl-, (3′S-trans)-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 2′,3′-dihydro-3′β,6′α-dihydroxy-2′,2′,4′,6′-tetramethyl-
- Illudin M
- Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 2',3'-dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethyl-, (3'S,6'R)-
- (3'S,6'R)-2',3'-Dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethylspiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Illudin M
CAS:Illudin M is a cytotoxic sesquiterpene from the fungus O.
Formula:C15H20O3Purity:99.46%Color and Shape:SolidMolecular weight:248.32Illudin M
CAS:Illudin M is a natural compound, categorized as a sesquiterpene. It is derived from certain species of mushrooms, notably those in the Omphalotus genus, such as the jack-o'-lantern mushroom (Omphalotus illudens). The mode of action of Illudin M involves targeting and damaging DNA within cells. Due to its cytotoxic nature, it interferes with DNA synthesis, leading to cell death, particularly in rapidly dividing cells.
Formula:C15H20O3Purity:Min. 95%Molecular weight:248.14124


