CAS 1146-72-1
:4-ACETYL-1,8-NAPHTHALIC ANHYDRIDE
Description:
4-Acetyl-1,8-naphthalic anhydride, with the CAS number 1146-72-1, is an organic compound characterized by its anhydride functional group and a naphthalene backbone. This substance appears as a white to light yellow crystalline solid and is known for its reactivity, particularly in acylation reactions. It has a melting point that typically falls within a moderate range, indicating its solid state at room temperature. The compound is soluble in organic solvents such as acetone and chloroform but is generally insoluble in water, reflecting its hydrophobic nature. 4-Acetyl-1,8-naphthalic anhydride is utilized in organic synthesis, particularly in the production of dyes, pharmaceuticals, and as an intermediate in various chemical reactions. Its structure allows for electrophilic substitution reactions, making it a valuable building block in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C14H8O4
InChI:InChI=1/C14H8O4/c1-7(15)8-5-6-11-12-9(8)3-2-4-10(12)13(16)18-14(11)17/h2-6H,1H3
SMILES:CC(=O)c1ccc2c3c1cccc3C(=O)OC2=O
Synonyms:- 6-acetyl-1H,3H-benzo[de]isochromene-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Acetyl-1,8-naphthalic anhydride
CAS:<p>4-Acetyl-1,8-naphthalic anhydride is a naphthoquinone that has been shown to have apoptosis-inducing properties. It inhibits mitochondrial electron transport and the generation of ATP, leading to cell death. 4-Acetyl-1,8-naphthalic anhydride also binds to DNA, which prevents transcription and replication. This compound can be used in vivo assays to evaluate the efficacy of anticancer drugs by determining tumor growth inhibition or the induction of apoptosis in cancer cells. The binding affinity of 4-acetyl-1,8-naphthalic anhydride for DNA is approximately two orders of magnitude higher than its affinity for other cellular components such as proteins or lipids.</p>Formula:C14H8O4Purity:Min. 90%Color and Shape:PowderMolecular weight:240.21 g/mol
