CAS 114601-41-1

[3,3′-Bipyrrolidine]-5,5′-dione

Description:

[3,3′-Bipyrrolidine]-5,5′-dione, with the CAS number 114601-41-1, is a chemical compound characterized by its unique bipyrrolidine structure, which consists of two pyrrolidine rings connected by a carbon-carbon bond. This compound features two carbonyl groups (diones) at the 5 and 5' positions of the bipyrrolidine framework, contributing to its reactivity and potential applications in organic synthesis. The presence of the dione functional groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound is likely to exhibit properties typical of diketones, including potential tautomerism and the ability to form enolates. Its structural characteristics may also influence its solubility, stability, and interaction with other chemical species. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in the development of novel compounds.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c11-7-1-5(3-9-7)6-2-8(12)10-4-6/h5-6H,1-4H2,(H,9,11)(H,10,12)

InChI key: InChIKey=UZDUDQBSVXFKME-UHFFFAOYSA-N

SMILES: O=C1CC(CN1)C2CC(=O)NC2

Synonyms:

• [3,3′-Bipyrrolidine]-5,5′-dione

[3,3'-Bipyrrolidine]-5,5'-dione

CAS: 114601-41-1

Formula: C₈H₁₂N₂O₂

Molecular weight: 168.1931

Ref: IN-DA000ESN