CAS 114607-51-1

Heptanoic acid, 4-amino-3-hydroxy-5-methyl-, (3R*,4S*,5S*)-

Description:

Heptanoic acid, 4-amino-3-hydroxy-5-methyl-, (3R*,4S*,5S*)- is a chiral compound characterized by its specific stereochemistry, denoted by the (3R*,4S*,5S*) configuration. This substance features a heptanoic acid backbone, which is a seven-carbon straight-chain fatty acid, indicating it possesses both hydrophobic and hydrophilic properties due to the presence of the carboxylic acid functional group. The amino group (-NH2) and hydroxyl group (-OH) contribute to its polar characteristics, making it more soluble in water compared to non-polar fatty acids. The methyl group at the 5-position introduces branching, which can influence its physical properties and biological activity. This compound may exhibit various biological functions, potentially acting as a signaling molecule or influencing metabolic pathways. Its stereochemistry is crucial for its interaction with biological systems, as the specific arrangement of atoms can affect its reactivity and binding to enzymes or receptors. Overall, this compound is of interest in fields such as biochemistry and medicinal chemistry due to its unique structure and potential applications.

Formula: C₈H₁₇NO₃

InChI: InChI=1S/C8H17NO3/c1-3-5(2)8(9)6(10)4-7(11)12/h5-6,8,10H,3-4,9H2,1-2H3,(H,11,12)/t5-,6+,8-/m0/s1

InChI key: InChIKey=NUOADXFOULDPJQ-BBVRLYRLSA-N

SMILES: [C@H]([C@H]([C@H](CC)C)N)(CC(O)=O)O

Synonyms:

• Heptanoic acid, 4-amino-3-hydroxy-5-methyl-, (3R*,4S*,5S*)-
• Isostatin