CAS 1146080-19-4
:3-[3-(Hydroxymethyl)-1-piperidinyl]-1-phenyl-1-propanone
Description:
3-[3-(Hydroxymethyl)-1-piperidinyl]-1-phenyl-1-propanone, identified by its CAS number 1146080-19-4, is a chemical compound that features a piperidine ring substituted with a hydroxymethyl group, alongside a phenyl group and a ketone functional group. This compound is characterized by its molecular structure, which includes a piperidine moiety that contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the hydroxymethyl group may enhance its solubility and reactivity, while the phenyl group can influence its electronic properties and interactions with biological targets. As a ketone, it may also participate in various chemical reactions, including nucleophilic additions. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its purity and the conditions under which it is studied. Overall, this compound is of interest in research contexts, particularly in the development of pharmaceuticals or as a synthetic intermediate in organic chemistry.
Formula:C15H21NO2
InChI:InChI=1S/C15H21NO2/c17-12-13-5-4-9-16(11-13)10-8-15(18)14-6-2-1-3-7-14/h1-3,6-7,13,17H,4-5,8-12H2
InChI key:InChIKey=XWPDSOSNNQNOSM-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=CC=C1)N2CC(CO)CCC2
Synonyms:- 3-[3-(Hydroxymethyl)-1-piperidinyl]-1-phenyl-1-propanone
- 1-Propanone, 3-[3-(hydroxymethyl)-1-piperidinyl]-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-(Hydroxymethyl)piperidin-1-yl)-1-phenylpropan-1-one
CAS:Formula:C15H21NO2Molecular weight:247.3327

