CAS 1146080-21-8
:(2-Fluorophenyl)(3-hydroxy-1-piperidinyl)methanone
Description:
(2-Fluorophenyl)(3-hydroxy-1-piperidinyl)methanone, identified by its CAS number 1146080-21-8, is a chemical compound characterized by its unique structural features. It contains a fluorinated phenyl group, which enhances its lipophilicity and may influence its biological activity. The presence of a piperidine ring contributes to its potential as a pharmacophore, often associated with various therapeutic effects. The hydroxyl group at the 3-position of the piperidine adds polarity and can participate in hydrogen bonding, which may affect the compound's solubility and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with specific receptors or enzymes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and potential applications would be of interest in both research and industrial contexts. Further studies would be necessary to fully elucidate its pharmacological profile and potential uses.
Formula:C12H14FNO2
InChI:InChI=1S/C12H14FNO2/c13-11-6-2-1-5-10(11)12(16)14-7-3-4-9(15)8-14/h1-2,5-6,9,15H,3-4,7-8H2
InChI key:InChIKey=NSYNLOSNXLQZCE-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(O)CCC1)C2=C(F)C=CC=C2
Synonyms:- (2-Fluorophenyl)(3-hydroxy-1-piperidinyl)methanone
- Methanone, (2-fluorophenyl)(3-hydroxy-1-piperidinyl)-
- (2-Fluoro-phenyl)-(3-hydroxy-piperidin-1-yl)-Methanone, 98+% C12H14FNO2, MW: 223.25
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.