CymitQuimica logo

CAS 1146080-25-2

:

4-Chloro-6-[1-(2-pyrazinyl)ethoxy]pyrimidine

Description:
4-Chloro-6-[1-(2-pyrazinyl)ethoxy]pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position introduces a halogen, enhancing the compound's reactivity and potential biological activity. The ethoxy group at the 6-position, linked to a 2-pyrazinyl moiety, contributes to the compound's solubility and may influence its pharmacological properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrimidine structure can lead to various biological activities, including antimicrobial and antiviral effects. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many heterocyclic compounds, the specific characteristics, such as melting point, solubility, and stability, can vary based on the surrounding conditions and the presence of other functional groups.
Formula:C10H9ClN4O
InChI:InChI=1S/C10H9ClN4O/c1-7(8-5-12-2-3-13-8)16-10-4-9(11)14-6-15-10/h2-7H,1H3
InChI key:InChIKey=BISVYYGPNPYRDN-UHFFFAOYSA-N
SMILES:C(OC=1C=C(Cl)N=CN1)(C)C=2C=NC=CN2
Synonyms:
  • 4-Chloro-6-[1-(2-pyrazinyl)ethoxy]pyrimidine
  • Pyrimidine, 4-chloro-6-[1-(2-pyrazinyl)ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.