CymitQuimica logo

CAS 1146080-29-6

:

2-Chloro-N-[1-(2-fluorobenzoyl)-4-piperidinyl]acetamide

Description:
2-Chloro-N-[1-(2-fluorobenzoyl)-4-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, a piperidine ring, and a fluorobenzoyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The chloro substituent may influence its reactivity and biological activity, while the fluorobenzoyl group can enhance lipophilicity and affect pharmacokinetic properties. The presence of the piperidine ring suggests potential interactions with biological targets, making this compound of interest in medicinal chemistry. Its specific applications may vary, but it could be explored for therapeutic uses, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H16ClFN2O2
InChI:InChI=1S/C14H16ClFN2O2/c15-9-13(19)17-10-5-7-18(8-6-10)14(20)11-3-1-2-4-12(11)16/h1-4,10H,5-9H2,(H,17,19)
InChI key:InChIKey=AVVULMHDPNRDRO-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=CC=C1)N2CCC(NC(CCl)=O)CC2
Synonyms:
  • Acetamide, 2-chloro-N-[1-(2-fluorobenzoyl)-4-piperidinyl]-
  • 2-Chloro-N-[1-(2-fluorobenzoyl)-4-piperidinyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.