CAS 1146080-30-9

2-Chloro-N-[1-(4-fluorobenzoyl)-3-piperidinyl]acetamide

Description:

2-Chloro-N-[1-(4-fluorobenzoyl)-3-piperidinyl]acetamide is a chemical compound characterized by its specific structural features, including a chloro group and a piperidine ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its piperidine moiety. The presence of the 4-fluorobenzoyl group suggests that it may interact with biological targets, making it of interest in medicinal chemistry. The chloro substituent can influence the compound's reactivity and stability, potentially affecting its pharmacokinetic properties. As with many organic compounds, its behavior in various environments, such as in solution or as a solid, can vary significantly based on factors like temperature and pH. Additionally, safety and handling considerations are important, as halogenated compounds can pose specific health risks. Overall, this compound's unique structure may contribute to its potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and effects.

Formula: C₁₄H₁₆ClFN₂O₂

InChI: InChI=1S/C14H16ClFN2O2/c15-8-13(19)17-12-2-1-7-18(9-12)14(20)10-3-5-11(16)6-4-10/h3-6,12H,1-2,7-9H2,(H,17,19)

InChI key: InChIKey=RALPZPVUEMBDDM-UHFFFAOYSA-N

SMILES: C(=O)(N1CC(NC(CCl)=O)CCC1)C2=CC=C(F)C=C2

Synonyms:

• Acetamide, 2-chloro-N-[1-(4-fluorobenzoyl)-3-piperidinyl]-
• 2-Chloro-N-[1-(4-fluorobenzoyl)-3-piperidinyl]acetamide
• 2-Chloro-N-[1-(4-fluoro-benzoyl)-piperidin-3-yl]-acetaMide, 98+%, C14H16ClFN2O2, MW: 298.75