CAS 1146080-41-2
:2-Chloro-3-(1H-indol-3-yl)quinoxaline
Description:
2-Chloro-3-(1H-indol-3-yl)quinoxaline is a chemical compound characterized by its unique structure, which combines a quinoxaline moiety with an indole group. This compound features a chlorine atom at the 2-position of the quinoxaline ring and an indole substituent at the 3-position, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of both the chloro and indole functionalities suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular interactions, stability, and reactivity can be influenced by the electronic properties of the substituents and the overall molecular geometry. As with many heterocyclic compounds, it may also exhibit fluorescence properties, making it useful in various analytical applications.
Formula:C16H10ClN3
InChI:InChI=1S/C16H10ClN3/c17-16-15(19-13-7-3-4-8-14(13)20-16)11-9-18-12-6-2-1-5-10(11)12/h1-9,18H
InChI key:InChIKey=DPOWLBZLTOWBQN-UHFFFAOYSA-N
SMILES:ClC=1C(C=2C=3C(NC2)=CC=CC3)=NC4=C(N1)C=CC=C4
Synonyms:- 2-Chloro-3-(1H-indol-3-yl)quinoxaline
- Quinoxaline, 2-chloro-3-(1H-indol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.