CymitQuimica logo

CAS 1146080-49-0

:

1-[3-(Cyclopropylamino)-2-quinoxalinyl]-4-piperidinol

Description:
1-[3-(Cyclopropylamino)-2-quinoxalinyl]-4-piperidinol is a chemical compound characterized by its complex structure, which includes a quinoxaline moiety and a piperidinol group. This compound features a cyclopropylamino substituent, contributing to its unique pharmacological properties. It is typically classified as a small organic molecule and may exhibit biological activity, potentially serving as a lead compound in drug discovery. The presence of the piperidinol structure suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems. Its molecular structure allows for potential interactions through hydrogen bonding and hydrophobic interactions, which are crucial for binding to biological receptors. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it an interesting subject for further research in medicinal chemistry. As with many compounds in this class, understanding its pharmacokinetics and pharmacodynamics would be essential for evaluating its therapeutic potential.
Formula:C16H20N4O
InChI:InChI=1S/C16H20N4O/c21-12-7-9-20(10-8-12)16-15(17-11-5-6-11)18-13-3-1-2-4-14(13)19-16/h1-4,11-12,21H,5-10H2,(H,17,18)
InChI key:InChIKey=LADKVCQUKABLAG-UHFFFAOYSA-N
SMILES:N(C=1C(=NC2=C(N1)C=CC=C2)N3CCC(O)CC3)C4CC4
Synonyms:
  • 1-[3-(Cyclopropylamino)-2-quinoxalinyl]-4-piperidinol
  • 4-Piperidinol, 1-[3-(cyclopropylamino)-2-quinoxalinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.