CAS 1146080-51-4
:6-Chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-cyclopropyl-3-pyridinemethanamine
Description:
6-Chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-cyclopropyl-3-pyridinemethanamine, identified by its CAS number 1146080-51-4, is a chemical compound characterized by its complex structure, which includes multiple pyridine rings and a cyclopropyl group. This compound features chlorine substituents that enhance its reactivity and potential biological activity. It is primarily recognized for its role in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of the pyridine moieties suggests potential interactions with biological receptors, making it a candidate for further research in drug development. Additionally, the cyclopropyl group may contribute to the compound's conformational flexibility and influence its pharmacokinetic properties. As with many compounds in this class, understanding its solubility, stability, and interaction with biological systems is crucial for assessing its therapeutic potential. Safety and handling considerations are also important, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C15H15Cl2N3
InChI:InChI=1S/C15H15Cl2N3/c16-14-5-1-11(7-18-14)9-20(13-3-4-13)10-12-2-6-15(17)19-8-12/h1-2,5-8,13H,3-4,9-10H2
InChI key:InChIKey=ZOCQQJSWOJQFRN-UHFFFAOYSA-N
SMILES:N(CC=1C=CC(Cl)=NC1)(CC=2C=CC(Cl)=NC2)C3CC3
Synonyms:- 6-Chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-cyclopropyl-3-pyridinemethanamine
- 3-Pyridinemethanamine, 6-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.