CAS 1146080-79-6
:2-[(2-Bromo-3-pyridinyl)oxy]pyrimidine
Description:
2-[(2-Bromo-3-pyridinyl)oxy]pyrimidine is a chemical compound characterized by its pyrimidine and pyridine moieties, which contribute to its heterocyclic structure. The presence of a bromine atom at the 2-position of the pyridine ring enhances its reactivity and potential for substitution reactions. This compound typically exhibits properties such as moderate solubility in polar organic solvents, which is common for heterocycles, and may display biological activity due to its structural features. The ether linkage between the pyrimidine and pyridine rings suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its unique structural characteristics that can influence its pharmacokinetic and pharmacodynamic properties. As with many heterocyclic compounds, it may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.
Formula:C9H6BrN3O
InChI:InChI=1S/C9H6BrN3O/c10-8-7(3-1-4-11-8)14-9-12-5-2-6-13-9/h1-6H
InChI key:InChIKey=WKUXGTBJENIFMU-UHFFFAOYSA-N
SMILES:O(C1=C(Br)N=CC=C1)C=2N=CC=CN2
Synonyms:- Pyrimidine, 2-[(2-bromo-3-pyridinyl)oxy]-
- 2-[(2-Bromo-3-pyridinyl)oxy]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
