CAS 114610-10-5
:1-(4-fluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)cinnoline-3-carboxylic acid
Description:
1-(4-Fluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)cinnoline-3-carboxylic acid, with the CAS number 114610-10-5, is a synthetic organic compound characterized by its complex structure, which includes a cinnoline core, multiple fluorine substituents, and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, while the piperazine group can contribute to interactions with biological targets, such as receptors or enzymes. The carboxylic acid functional group may impart acidic properties, influencing its behavior in biological systems and its potential as a drug candidate. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutics targeting specific diseases. Further studies would be necessary to fully elucidate its pharmacological profile and potential therapeutic uses.
Formula:C19H16F2N4O3
InChI:InChI=1/C19H16F2N4O3/c20-11-1-3-12(4-2-11)25-15-10-16(24-7-5-22-6-8-24)14(21)9-13(15)18(26)17(23-25)19(27)28/h1-4,9-10,22H,5-8H2,(H,27,28)
SMILES:c1cc(ccc1F)n1c2cc(c(cc2c(=O)c(C(=O)O)n1)F)N1CCNCC1
Synonyms:- Fpfpcc
- 6-Fluoro-1-(4-Fluorophenyl)-4-Oxo-7-(Piperazin-1-Yl)-1,4-Dihydrocinnoline-3-Carboxylic Acid
- 1-(4-Fluorophenyl)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)cinnoline-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Cinnolinecarboxylic acid, 6-fluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
CAS:Formula:C19H16F2N4O3Molecular weight:386.3521
