
CAS 114611-55-1
:Androsta-4,16-diene-3,6-dione
Description:
Androsta-4,16-diene-3,6-dione, with the CAS number 114611-55-1, is a synthetic steroid compound that belongs to the class of androgens and anabolic steroids. It is characterized by its unique structure, which features a steroid backbone with specific double bonds and keto groups at the 3 and 6 positions. This compound is often studied for its potential effects on muscle growth and performance enhancement, as well as its role in various biochemical pathways. It exhibits properties that may influence androgen receptor activity, making it of interest in both pharmacological and research contexts. Additionally, Androsta-4,16-diene-3,6-dione may have implications in the study of hormonal regulation and steroidogenesis. Its solubility, stability, and reactivity can vary depending on the conditions, and it is typically handled with care in laboratory settings due to its biological activity. As with many steroid derivatives, understanding its pharmacokinetics and potential side effects is crucial for its application in both clinical and athletic environments.
Formula:C19H24O2
InChI:InChI=1S/C19H24O2/c1-18-7-3-4-14(18)13-11-17(21)16-10-12(20)5-9-19(16,2)15(13)6-8-18/h3,7,10,13-15H,4-6,8-9,11H2,1-2H3/t13-,14-,15-,18-,19+/m0/s1
InChI key:InChIKey=GOJSMZGIOCBZMX-UNTXSKPGSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)C=CC4)[H])(CC(=O)C1=CC(=O)CC2)[H])[H]
Synonyms:- Androsta-4,16-diene-3,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
