CAS 114611-59-5
:PFBOA-ACETALDEHYDE
Description:
PFBOA-acetaldehyde, with the CAS number 114611-59-5, is a chemical compound that belongs to the class of perfluorinated compounds. It is characterized by the presence of a perfluorobutyl group, which imparts unique properties such as high thermal stability, chemical resistance, and low surface tension. The acetaldehyde moiety contributes to its reactivity, making it useful in various chemical applications. PFBOA-acetaldehyde is typically a colorless liquid at room temperature and exhibits low volatility. Its perfluorinated structure often leads to hydrophobic and oleophobic characteristics, making it valuable in coatings and surfactants. Additionally, compounds like PFBOA-acetaldehyde are of interest in environmental studies due to their persistence and potential bioaccumulation in ecosystems. Safety data should be consulted for handling and exposure guidelines, as perfluorinated compounds can have significant environmental and health implications. Overall, PFBOA-acetaldehyde is a notable compound in the field of fluorinated chemistry with diverse applications and implications.
Formula:C9H6F5NO
InChI:InChI=1/C9H6F5NO/c1-2-15-16-3-4-5(10)7(12)9(14)8(13)6(4)11/h2H,3H2,1H3/b15-2+
Synonyms:- Acetaldehyde-O-pentafluorophenylmethyl-oxime
- acetaldehyde-O-pentafluorobenzyloxime
- Pfboa-Acetaldehyde Standard
- Acetaldehyde O-2,3,4,5,6-PFBHA-oxime
- (1E)-N-[(pentafluorobenzyl)oxy]ethanimine
- PFBOA-ACETALDEHYDE
- Acetaldehyde, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime
- N-Ethylidene-O-(2,3,4,5,6-pentafluorobenzyl)hydroxylamine
- N-Ethylidene[(2,3,4,5,6-pentafluorobenzyl)oxy]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetaldehyde, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime
CAS:Formula:C9H6F5NOMolecular weight:239.1421
