CAS 114611-60-8

2,2,5,5-tetrakis(trifluoromethyl)-3-imidazoline

Description:

2,2,5,5-tetrakis(trifluoromethyl)-3-imidazoline is a synthetic organic compound characterized by its unique imidazoline structure, which incorporates multiple trifluoromethyl groups. This compound is notable for its high fluorine content, which imparts distinct chemical properties, including increased lipophilicity and thermal stability. The presence of trifluoromethyl groups enhances its electron-withdrawing characteristics, potentially affecting its reactivity and interactions with other chemical species. As an imidazoline derivative, it may exhibit properties such as coordination with metal ions, making it of interest in various applications, including catalysis and materials science. Additionally, the compound's structure suggests potential uses in the development of specialty chemicals or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, 2,2,5,5-tetrakis(trifluoromethyl)-3-imidazoline represents a fascinating example of fluorinated organic chemistry with potential applications in advanced materials and chemical processes.

Formula: C₇H₂F₁₂N₂

InChI: InChI=1/C7H2F12N2/c8-4(9,10)2(5(11,12)13)1-20-3(21-2,6(14,15)16)7(17,18)19/h1,21H

SMILES: C1=NC(C(F)(F)F)(C(F)(F)F)NC1(C(F)(F)F)C(F)(F)F

Synonyms:

• Ttfmi
• 2,2,5,5-tetrakis(trifluoromethyl)-2,5-dihydro-1H-imidazole
• 2,2,5,5-Tetrakis(trifluoromethyl)-3-imidazoline

1H-Imidazole, 2,5-dihydro-2,2,5,5-tetrakis(trifluoromethyl)-

CAS: 114611-60-8

Formula: C₇H₂F₁₂N₂

Molecular weight: 342.085

Ref: IN-DA000ETQ