CAS 1146119-42-7
:1-Piperazinyl(4-propylphenyl)methanone
Description:
1-Piperazinyl(4-propylphenyl)methanone is a chemical compound characterized by its piperazine moiety, which is a six-membered ring containing two nitrogen atoms. This compound features a propyl group attached to a phenyl ring, contributing to its hydrophobic characteristics. The methanone functional group indicates the presence of a carbonyl (C=O) group, which can influence the compound's reactivity and interactions with biological targets. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The presence of the piperazine ring often suggests potential applications in the development of psychoactive or therapeutic agents, as piperazine derivatives are known for their diverse biological activities. Additionally, the structural features of 1-Piperazinyl(4-propylphenyl)methanone may allow for interactions with various receptors or enzymes, potentially leading to specific pharmacodynamic effects. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding environment and conditions.
Formula:C14H20N2O
InChI:InChI=1S/C14H20N2O/c1-2-3-12-4-6-13(7-5-12)14(17)16-10-8-15-9-11-16/h4-7,15H,2-3,8-11H2,1H3
InChI key:InChIKey=GPAHJZIJPCELJB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCC)C=C1)N2CCNCC2
Synonyms:- Methanone, 1-piperazinyl(4-propylphenyl)-
- 1-Piperazinyl(4-propylphenyl)methanone
- 1-(4-Propylbenzoyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.