CAS 114616-11-4
:(5S,6Z,8E,10E,12R)-5,12-Dihydroxy-6,8,10-eicosatrien-14-ynoic acid
Description:
The chemical substance known as (5S,6Z,8E,10E,12R)-5,12-Dihydroxy-6,8,10-eicosatrien-14-ynoic acid, with the CAS number 114616-11-4, is a polyunsaturated fatty acid characterized by multiple double bonds and hydroxyl groups in its structure. This compound features a long carbon chain, specifically an eicosatrienoic backbone, which contributes to its unique physical and chemical properties. The presence of hydroxyl groups indicates that it can engage in hydrogen bonding, potentially affecting its solubility and reactivity. The specific stereochemistry, denoted by the (5S,6Z,8E,10E,12R) configuration, suggests that the molecule has distinct spatial arrangements that can influence its biological activity and interactions with other molecules. Such compounds are often studied for their roles in biological systems, including potential anti-inflammatory and signaling functions. Additionally, the presence of a triple bond (alkyne) in the structure may impart unique reactivity, making it of interest in synthetic organic chemistry and biochemistry.
Formula:C20H30O4
InChI:InChI=1S/C20H30O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h7-8,10-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,14-10+,15-11-/t18-,19-/m1/s1
InChI key:InChIKey=PRCVOEPTHWOJMX-CHHAPGPYSA-N
SMILES:C(=C\C=C\C=C\[C@@H](CC#CCCCCC)O)\[C@H](CCCC(O)=O)O
Synonyms:- (5S,6Z,8E,10E,12R)-5,12-Dihydroxy-6,8,10-eicosatrien-14-ynoic acid
- 14,15-Dehydroleukotriene B<sub>4</sub>
- 5S,12R-Dihydroxy-6Z,8E,10E-Eicosatrien-14-Ynoic Acid
- 6,8,10-Eicosatrien-14-ynoic acid, 5,12-dihydroxy-, (5S,6Z,8E,10E,12R)-
- 6,8,10-Eicosatrien-14-ynoic acid, 5,12-dihydroxy-, [S-[R*,S*-(E,Z,E)]]-
- 14,15-Dehydroleukotriene B4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6,8,10-Eicosatrien-14-ynoic acid, 5,12-dihydroxy-, (5S,6Z,8E,10E,12R)-
CAS:Formula:C20H34O4Molecular weight:338.481614,15-dehydro Leukotriene B4
CAS:LTB4 is a leukocyte-activating fatty acid via 5-lipoxygenase. Two receptors, BLT1 and BLT2, bind it. 14,15-dehydro LTB4 is a stronger BLT1 antagonist.Formula:C20H30O4Color and Shape:SolidMolecular weight:334.45

