CAS 1146210-65-2

Methyl 2,5-difluorobenzenecarbodithioate

Description:

Methyl 2,5-difluorobenzenecarbodithioate is an organic compound characterized by its unique structure, which includes a methyl group, two fluorine atoms positioned at the 2 and 5 positions on a benzene ring, and a carbodithioate functional group. This compound is part of the larger class of dithioates, which are known for their sulfur-containing functional groups that can exhibit interesting chemical reactivity. The presence of fluorine atoms typically enhances the compound's stability and can influence its polarity and solubility in various solvents. Methyl 2,5-difluorobenzenecarbodithioate may be utilized in various applications, including as an intermediate in organic synthesis or in the development of agrochemicals. Its specific properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the environment in which it is used. Safety data and handling precautions should be consulted due to the potential hazards associated with fluorinated compounds and those containing sulfur.

Formula: C₈H₆F₂S₂

InChI: InChI=1S/C8H6F2S2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3

InChI key: InChIKey=BRGIHOPYNRNMDQ-UHFFFAOYSA-N

SMILES: C(SC)(=S)C1=C(F)C=CC(F)=C1

Synonyms:

• Benzenecarbodithioic acid, 2,5-difluoro-, methyl ester
• (2,5-Difluorophenyl)(methylsulfanyl)methanethione
• Methyl 2,5-difluorobenzenecarbodithioate