CAS 114624-72-5
:N-(Aminocarbonyl)-3-methoxy-O-methyltyrosine
Description:
N-(Aminocarbonyl)-3-methoxy-O-methyltyrosine, with the CAS number 114624-72-5, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a methoxy group and an O-methyl group, which contribute to its unique chemical properties. It is characterized by the presence of an aminocarbonyl functional group, which is indicative of its potential biological activity. The methoxy and O-methyl substitutions enhance its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural features suggest that it could interact with various receptors or enzymes, making it a candidate for further investigation in medicinal chemistry. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential applications.
Formula:C12H16N2O5
InChI:InChI=1S/C12H16N2O5/c1-18-9-4-3-7(6-10(9)19-2)5-8(11(15)16)14-12(13)17/h3-4,6,8H,5H2,1-2H3,(H,15,16)(H3,13,14,17)
InChI key:InChIKey=JTELTMYDFKDHNK-UHFFFAOYSA-N
SMILES:C(C(NC(N)=O)C(O)=O)C1=CC(OC)=C(OC)C=C1
Synonyms:- N-(Aminocarbonyl)-3-methoxy-O-methyltyrosine
- Tyrosine, N-(aminocarbonyl)-3-methoxy-O-methyl-
- DL-Tyrosine, N-(aminocarbonyl)-3-methoxy-O-methyl-
- 2-(Carbamoylamino)-3-(3,4-dimethoxyphenyl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
