CAS 1146289-83-9

1-(1,1,2,2,3,3,3-Heptafluoropropoxy)-4-nitrobenzene

Description:

1-(1,1,2,2,3,3,3-Heptafluoropropoxy)-4-nitrobenzene is a synthetic organic compound characterized by its unique structure, which includes a nitro group and a heptafluoropropoxy moiety. This compound features a benzene ring substituted with a nitro group at the para position and a heptafluoropropoxy group, which contributes to its distinctive chemical properties. The presence of fluorine atoms enhances its thermal stability and hydrophobicity, making it useful in various applications, including as a potential intermediate in the synthesis of fluorinated compounds. The nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and polarity. Additionally, the heptafluoropropoxy group can impart unique solubility characteristics, affecting its behavior in different solvents. Overall, this compound is of interest in materials science and organic synthesis, particularly in the development of fluorinated materials and pharmaceuticals. Safety data and handling precautions should be observed due to the potential hazards associated with both the nitro and fluorinated functionalities.

Formula: C₉H₄F₇NO₃

InChI: InChI=1S/C9H4F7NO3/c10-7(11,8(12,13)14)9(15,16)20-6-3-1-5(2-4-6)17(18)19/h1-4H

InChI key: InChIKey=WWIOFXKRADGKJG-UHFFFAOYSA-N

SMILES: C(C(C(F)(F)F)(F)F)(OC1=CC=C(N(=O)=O)C=C1)(F)F

Synonyms:

• Benzene, 1-(1,1,2,2,3,3,3-heptafluoropropoxy)-4-nitro-
• 1-(1,1,2,2,3,3,3-Heptafluoropropoxy)-4-nitrobenzene