CAS 1146289-87-3

3-(1-Cyclohexen-1-yl)-2,3-dihydro-2-oxo-1H-benzimidazole-1-acetic acid

Description:

3-(1-Cyclohexen-1-yl)-2,3-dihydro-2-oxo-1H-benzimidazole-1-acetic acid, with the CAS number 1146289-87-3, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound is characterized by the presence of a cyclohexenyl substituent, contributing to its unique structural properties and potential reactivity. The presence of a carboxylic acid functional group (acetic acid) suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the diketone functionality (2-oxo) indicates potential for tautomerization and reactivity in condensation reactions. The compound may have applications in medicinal chemistry, particularly due to the biological activity often associated with benzimidazole derivatives. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₅H₁₆N₂O₃

InChI: InChI=1S/C15H16N2O3/c18-14(19)10-16-12-8-4-5-9-13(12)17(15(16)20)11-6-2-1-3-7-11/h4-6,8-9H,1-3,7,10H2,(H,18,19)

InChI key: InChIKey=RTCNCJYIXJQJCY-UHFFFAOYSA-N

SMILES: O=C1N(C=2C(N1CC(O)=O)=CC=CC2)C=3CCCCC3

Synonyms:

• 1H-Benzimidazole-1-acetic acid, 3-(1-cyclohexen-1-yl)-2,3-dihydro-2-oxo-
• 2-(3-(Cyclohexenyl)-2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)acetic acid
• 3-(1-Cyclohexen-1-yl)-2,3-dihydro-2-oxo-1H-benzimidazole-1-acetic acid
• 2-[3-(Cyclohex-1-en-1-yl)-2-oxo-2,3-dihydro-1H-1,3-benzodiazol-1-yl]acetic acid

2-[3-(Cyclohex-1-en-1-yl)-2-oxo-2,3-dihydro-1H-1,3-benzodiazol-1-yl]acetic acid

CAS: 1146289-87-3

Versatile small molecule scaffold

Formula: C₁₅H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 272.3 g/mol

Ref: 3D-WVB28987