CymitQuimica logo

CAS 1146289-99-7

:

3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-methylphenyl)methyl]benzamide

Description:
The chemical substance known as 3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-methylphenyl)methyl]benzamide, with the CAS number 1146289-99-7, is characterized by its complex molecular structure, which includes an imidazole ring and a benzamide moiety. This compound features a thioxo group, contributing to its potential reactivity and biological activity. The presence of the 4-methylphenyl group suggests that it may exhibit hydrophobic interactions, influencing its solubility and interaction with biological targets. The imidazole ring is known for its role in various biochemical processes, including enzyme catalysis and as a building block in pharmaceuticals. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed through various analytical methods. Overall, this compound represents a class of molecules that may have applications in drug development or as biochemical probes.
Formula:C18H17N3OS
InChI:InChI=1S/C18H17N3OS/c1-13-5-7-14(8-6-13)12-20-17(22)15-3-2-4-16(11-15)21-10-9-19-18(21)23/h2-11H,12H2,1H3,(H,19,23)(H,20,22)
InChI key:InChIKey=IRVRNXXSLDFCBU-UHFFFAOYSA-N
SMILES:S=C1N(C2=CC(C(NCC3=CC=C(C)C=C3)=O)=CC=C2)C=CN1
Synonyms:
  • Benzamide, 3-(2,3-dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-methylphenyl)methyl]-
  • 3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-methylphenyl)methyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.