CymitQuimica logo

CAS 1146290-01-8

:

3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-fluorophenyl)methyl]benzamide

Description:
3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-fluorophenyl)methyl]benzamide, identified by its CAS number 1146290-01-8, is a synthetic organic compound characterized by its complex structure, which includes an imidazole ring and a benzamide moiety. The presence of a thioxo group contributes to its potential reactivity and biological activity. This compound features a fluorinated phenyl group, which can influence its pharmacokinetic properties, such as lipophilicity and binding affinity to biological targets. The imidazole ring is known for its role in various biological systems and can participate in hydrogen bonding and coordination with metal ions. The compound may exhibit diverse biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. As with many synthetic compounds, further studies would be necessary to fully elucidate its potential applications and mechanisms of action.
Formula:C17H14FN3OS
InChI:InChI=1S/C17H14FN3OS/c18-14-6-4-12(5-7-14)11-20-16(22)13-2-1-3-15(10-13)21-9-8-19-17(21)23/h1-10H,11H2,(H,19,23)(H,20,22)
InChI key:InChIKey=RIQJRRHVLKZZKO-UHFFFAOYSA-N
SMILES:S=C1N(C2=CC(C(NCC3=CC=C(F)C=C3)=O)=CC=C2)C=CN1
Synonyms:
  • Benzamide, 3-(2,3-dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-fluorophenyl)methyl]-
  • 3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-[(4-fluorophenyl)methyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.