CAS 1146290-11-0
:2-[[(2,2-Dichlorocyclopropyl)methyl]thio]benzenamine
Description:
2-[[(2,2-Dichlorocyclopropyl)methyl]thio]benzenamine, with the CAS number 1146290-11-0, is a chemical compound characterized by its unique structure that includes a dichlorocyclopropyl group and a thiomethyl linkage to a benzenamine moiety. This compound typically exhibits properties associated with both aromatic amines and sulfur-containing compounds, which may influence its reactivity and solubility. The presence of the dichlorocyclopropyl group suggests potential for specific interactions in biological systems, possibly affecting its pharmacological profile. Additionally, the thiol group can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The compound's molecular structure may impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Overall, 2-[[(2,2-Dichlorocyclopropyl)methyl]thio]benzenamine is of interest in fields such as medicinal chemistry and agrochemicals, where its unique characteristics may be leveraged for various applications.
Formula:C10H11Cl2NS
InChI:InChI=1S/C10H11Cl2NS/c11-10(12)5-7(10)6-14-9-4-2-1-3-8(9)13/h1-4,7H,5-6,13H2
InChI key:InChIKey=ABBVLAQJFLFDOB-UHFFFAOYSA-N
SMILES:C(SC1=C(N)C=CC=C1)C2C(Cl)(Cl)C2
Synonyms:- Benzenamine, 2-[[(2,2-dichlorocyclopropyl)methyl]thio]-
- 2-[[(2,2-Dichlorocyclopropyl)methyl]thio]benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.