CymitQuimica logo

CAS 1146290-17-6

:

N-(2-Butyl-1H-benzimidazol-6-yl)acetamide

Description:
N-(2-Butyl-1H-benzimidazol-6-yl)acetamide is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety substituted with a butyl group and an acetamide functional group. This compound typically exhibits properties associated with both the benzimidazole and amide functional groups, such as potential biological activity and solubility in organic solvents. The presence of the butyl group may enhance lipophilicity, influencing its interaction with biological membranes. The compound may also exhibit specific reactivity patterns due to the amide linkage, which can participate in hydrogen bonding and other intermolecular interactions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Additionally, the compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the surrounding environment. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C13H17N3O
InChI:InChI=1S/C13H17N3O/c1-3-4-5-13-15-11-7-6-10(14-9(2)17)8-12(11)16-13/h6-8H,3-5H2,1-2H3,(H,14,17)(H,15,16)
InChI key:InChIKey=PJQFKAXVABNTKU-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C2C(N=C(CCCC)N2)=CC1
Synonyms:
  • N-(2-Butyl-1H-benzimidazol-6-yl)acetamide
  • Acetamide, N-(2-butyl-1H-benzimidazol-6-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.