CAS 1146290-18-7

7-Ethyl 2-methyl 6-(3-hydroxypropyl)[1,2,4]triazolo[1,5-a]pyrimidine-2,7-dicarboxylate

Description:

7-Ethyl 2-methyl 6-(3-hydroxypropyl)[1,2,4]triazolo[1,5-a]pyrimidine-2,7-dicarboxylate is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features multiple functional groups, including carboxylate and hydroxyl groups, which contribute to its potential reactivity and solubility in various solvents. The presence of ethyl and methyl substituents enhances its lipophilicity, potentially influencing its biological activity. The compound's unique structure may allow for interactions with specific biological targets, making it of interest in medicinal chemistry and drug development. Its CAS number, 1146290-18-7, serves as a unique identifier for regulatory and research purposes. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often exhibit moderate to high stability under standard laboratory conditions. Further studies would be necessary to elucidate its full chemical behavior and potential applications in pharmaceuticals or other fields.

Formula: C₁₃H₁₆N₄O₅

InChI: InChI=1S/C13H16N4O5/c1-3-22-11(19)9-8(5-4-6-18)7-14-13-15-10(12(20)21-2)16-17(9)13/h7,18H,3-6H2,1-2H3

InChI key: InChIKey=IXEAJYSLHUKWRY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N2C(=NC(C(OC)=O)=N2)N=CC1CCCO

Synonyms:

• 7-Ethyl 2-methyl 6-(3-hydroxypropyl)[1,2,4]triazolo[1,5-a]pyrimidine-2,7-dicarboxylate
• [1,2,4]Triazolo[1,5-a]pyrimidine-2,7-dicarboxylic acid, 6-(3-hydroxypropyl)-, 7-ethyl 2-methyl ester

7-Ethyl 2-methyl 6-(3-hydroxypropyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2,7-dicarboxylate

CAS: 1146290-18-7

Versatile small molecule scaffold

Formula: C₁₃H₁₆N₄O₅

Purity: Min. 95%

Molecular weight: 308.29 g/mol

Ref: 3D-WVB29018