CAS 1146290-27-8

4,5-Dihydro-4-(2-hydroxyethyl)-5-oxo-1-phenyl-1H-pyrazole-3-carboxylic acid

Description:

4,5-Dihydro-4-(2-hydroxyethyl)-5-oxo-1-phenyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a phenyl group indicates aromatic characteristics, which can influence its stability and interaction with other molecules. The hydroxyethyl substituent enhances its solubility in polar solvents and may participate in hydrogen bonding, affecting its biological activity and pharmacokinetics. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in various chemical reactions. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and biological applications.

Formula: C₁₂H₁₂N₂O₄

InChI: InChI=1S/C12H12N2O4/c15-7-6-9-10(12(17)18)13-14(11(9)16)8-4-2-1-3-5-8/h1-5,9,15H,6-7H2,(H,17,18)

InChI key: InChIKey=RECYHGJQIKPRDX-UHFFFAOYSA-N

SMILES: O=C1N(N=C(C(O)=O)C1CCO)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-4-(2-hydroxyethyl)-5-oxo-1-phenyl-
• 4,5-Dihydro-4-(2-hydroxyethyl)-5-oxo-1-phenyl-1H-pyrazole-3-carboxylic acid

4-(2-Hydroxyethyl)-5-oxo-1-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid

CAS: 1146290-27-8

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 248.23 g/mol

Ref: 3D-WVB29027