CymitQuimica logo

CAS 1146290-28-9

:

2-(3-Aminopropyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one

Description:
2-(3-Aminopropyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and a pyridine moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an amino group attached to a propyl chain, which contributes to its potential biological activity. The presence of the triazole ring suggests that it may exhibit properties typical of nitrogen-containing heterocycles, such as antimicrobial or antifungal activity. The compound's molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. As with many heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, influencing its pharmacokinetic properties. Further studies would be necessary to fully elucidate its potential applications and biological effects.
Formula:C9H16N4O
InChI:InChI=1S/C9H16N4O/c10-5-3-7-13-9(14)12-6-2-1-4-8(12)11-13/h1-7,10H2
InChI key:InChIKey=BJIMLKYZBPCONX-UHFFFAOYSA-N
SMILES:O=C1N2C(=NN1CCCN)CCCC2
Synonyms:
  • 2-(3-Aminopropyl)-5,6,7,8-tetrahydro-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one
  • 1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one, 2-(3-aminopropyl)-5,6,7,8-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.