CymitQuimica logo

CAS 1146290-29-0

:

2-(1-Methylethyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one

Description:
2-(1-Methylethyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one is a heterocyclic compound characterized by its complex structure, which includes a quinazolinone core fused with a triazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the triazole moiety often contributes to its ability to interact with biological targets, potentially influencing its pharmacological properties. Additionally, the isopropyl group (1-methylethyl) may enhance lipophilicity, affecting its absorption and distribution in biological systems. The compound's unique structure may also lead to specific reactivity patterns, making it suitable for various synthetic applications. Overall, 2-(1-Methylethyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one represents a class of compounds that could be explored for their therapeutic potential, particularly in areas such as oncology or infectious diseases, although further studies would be necessary to fully elucidate its biological activity and mechanism of action.
Formula:C12H12N4O
InChI:InChI=1S/C12H12N4O/c1-7(2)10-14-11-8-5-3-4-6-9(8)13-12(17)16(11)15-10/h3-7H,1-2H3,(H,13,17)
InChI key:InChIKey=YHVWWFFZNOCKSI-UHFFFAOYSA-N
SMILES:O=C1N2C(C=3C(N1)=CC=CC3)=NC(C(C)C)=N2
Synonyms:
  • 2-(1-Methylethyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
  • [1,2,4]Triazolo[1,5-c]quinazolin-5(6H)-one, 2-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.