CAS 1146290-37-0
:5-(1,3,4-Oxadiazol-2-yl)-2(1H)-pyridinone
Description:
5-(1,3,4-Oxadiazol-2-yl)-2(1H)-pyridinone is a heterocyclic compound characterized by the presence of both a pyridinone and an oxadiazole moiety. This compound typically exhibits a fused ring structure, which contributes to its unique chemical properties. The oxadiazole ring is known for its stability and potential biological activity, often being associated with antimicrobial and anti-inflammatory properties. The pyridinone component can enhance the compound's ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. Additionally, the presence of nitrogen atoms in both rings can influence the compound's solubility and reactivity. This substance may also exhibit fluorescence or other photophysical properties, depending on its specific electronic structure. Overall, 5-(1,3,4-Oxadiazol-2-yl)-2(1H)-pyridinone is a versatile compound with potential applications in pharmaceuticals and materials science, warranting further investigation into its biological and chemical behavior.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-6-2-1-5(3-8-6)7-10-9-4-12-7/h1-4H,(H,8,11)
InChI key:InChIKey=IHIZAFFHUCXEEG-UHFFFAOYSA-N
SMILES:O=C1C=CC(=CN1)C2=NN=CO2
Synonyms:- 2(1H)-Pyridinone, 5-(1,3,4-oxadiazol-2-yl)-
- 5-(1,3,4-Oxadiazol-2-yl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.