CAS 1146290-38-1
:3-Amino-N-(1-methyl-2-pyrrolidinylidene)benzenesulfonamide
Description:
3-Amino-N-(1-methyl-2-pyrrolidinylidene)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of an amino group indicates potential for hydrogen bonding, enhancing its solubility in polar solvents. The compound features a pyrrolidine ring, which contributes to its structural complexity and may influence its biological activity. The methyl group on the pyrrolidine nitrogen can affect the steric and electronic properties of the molecule, potentially impacting its interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its sulfonamide moiety is often associated with a range of therapeutic applications, including antimicrobial and anti-inflammatory effects. Additionally, the compound's stability, reactivity, and solubility can be influenced by the presence of the aromatic benzene ring, which can participate in π-π stacking interactions. Overall, 3-Amino-N-(1-methyl-2-pyrrolidinylidene)benzenesulfonamide represents a unique structure with potential applications in drug development and research.
Formula:C11H15N3O2S
InChI:InChI=1S/C11H15N3O2S/c1-14-7-3-6-11(14)13-17(15,16)10-5-2-4-9(12)8-10/h2,4-5,8H,3,6-7,12H2,1H3
InChI key:InChIKey=LWHNCKLZGOMLKW-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC(N)=CC=C1)=C2N(C)CCC2
Synonyms:- 3-Amino-N-(1-methylpyrrolidin-2-ylidene)benzene-1-sulfonamide
- Benzenesulfonamide, 3-amino-N-(1-methyl-2-pyrrolidinylidene)-
- 3-Amino-N-(1-methyl-2-pyrrolidinylidene)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.