CAS 1146290-39-2

1-[(1-Methyl-1H-imidazol-2-yl)methyl]-4-piperidinecarboxylic acid

Description:

1-[(1-Methyl-1H-imidazol-2-yl)methyl]-4-piperidinecarboxylic acid, identified by its CAS number 1146290-39-2, is a chemical compound characterized by its unique structural features, which include a piperidine ring and an imidazole moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, suggesting potential for hydrogen bonding and interactions with biological targets. The presence of the imidazole ring may impart basicity, while the carboxylic acid group contributes to its acidity and solubility in polar solvents. Such structural characteristics often indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may act as a ligand or a building block for more complex molecules. Additionally, the compound's ability to engage in various intermolecular interactions could enhance its efficacy in biological systems. Overall, its unique combination of functional groups positions it as a compound of interest in both research and application within the field of organic and medicinal chemistry.

Formula: C₁₁H₁₇N₃O₂

InChI: InChI=1S/C11H17N3O2/c1-13-7-4-12-10(13)8-14-5-2-9(3-6-14)11(15)16/h4,7,9H,2-3,5-6,8H2,1H3,(H,15,16)

InChI key: InChIKey=CFMOKBUCAUKLKX-UHFFFAOYSA-N

SMILES: C(C=1N(C)C=CN1)N2CCC(C(O)=O)CC2

Synonyms:

• 1-[(1-Methyl-1H-imidazol-2-yl)methyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(1-methyl-1H-imidazol-2-yl)methyl]-

1-[(1-Methyl-1H-imidazol-2-yl)methyl]piperidine-4-carboxylic acid

CAS: 1146290-39-2

Versatile small molecule scaffold

Formula: C₁₁H₁₇N₃O₂

Purity: Min. 95%

Molecular weight: 223.27 g/mol

Ref: 3D-WVB29039