CAS 1146290-41-6

Pyridine, 3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-

Description:

Pyridine, 3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chloromethyl group and a phenoxy group, indicating the presence of chlorine substituents that can influence its reactivity and solubility. The chloromethyl group enhances the electrophilic character of the molecule, making it potentially reactive in nucleophilic substitution reactions. The phenoxy moiety contributes to the compound's overall stability and can affect its interaction with biological systems. Pyridine derivatives are often used in pharmaceuticals, agrochemicals, and as solvents or intermediates in organic synthesis. The presence of chlorine atoms may impart specific biological activity or toxicity, necessitating careful handling and assessment of safety data. Overall, this compound exemplifies the diverse chemistry of pyridine derivatives, with applications that may span various fields, including medicinal chemistry and materials science.

Formula: C₁₃H₁₁Cl₂NO

InChI: InChI=1S/C13H11Cl2NO/c14-7-11-6-12(15)3-4-13(11)17-9-10-2-1-5-16-8-10/h1-6,8H,7,9H2

InChI key: InChIKey=ZPYCIHMYMHMNMK-UHFFFAOYSA-N

SMILES: O(CC=1C=CC=NC1)C2=C(CCl)C=C(Cl)C=C2

Synonyms:

• Pyridine, 3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-